C18H20N2O3S2 — CID 3033673
methanesulfonic acid;4-phenyl-N-(2-phenylethyl)-1,3-thiazol-2-amine (PubChem CID 3033673) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methanesulfonic acid;4-phenyl-N-(2-phenylethyl)-1,3-thiazol-2-amine.
| Compound Name | methanesulfonic acid;4-phenyl-N-(2-phenylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3033673 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methanesulfonic acid;4-phenyl-N-(2-phenylethyl)-1,3-thiazol-2-amine |
| SMILES | CS(=O)(=O)O.c1ccc(CCNc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H16N2S.CH4O3S/c1-3-7-14(8-4-1)11-12-18-17-19-16(13-20-17)15-9-5-2-6-10-15;1-5(2,3)4/h1-10,13H,11-12H2,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | FHXKFCNUYSGNFV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|