C19H25N4O6PS2 — CID 3033943
1-[2-(diethoxyphosphorylcarbamothioylamino)phenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 3033943) has the molecular formula C19H25N4O6PS2 and a molecular weight of 500.54 g/mol. Its IUPAC name is 1-[2-(diethoxyphosphorylcarbamothioylamino)phenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[2-(diethoxyphosphorylcarbamothioylamino)phenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 3033943 |
| Molecular Formula | C19H25N4O6PS2 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-[2-(diethoxyphosphorylcarbamothioylamino)phenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | CCOP(=O)(NC(=S)Nc1ccccc1NC(=O)NS(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C19H25N4O6PS2/c1-4-28-30(25,29-5-2)22-19(31)21-17-9-7-6-8-16(17)20-18(24)23-32(26,27)15-12-10-14(3)11-13-15/h6-13H,4-5H2,1-3H3,(H2,20,23,24)(H2,21,22,25,31) |
| InChIKey | NDXFLHPUUKVXLQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|