C21H20Cl2N2O4 — CID 30342976
2-(2,4-dichlorophenoxy)-N-methyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide (PubChem CID 30342976) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-methyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-methyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 30342976 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-methyl-N-[3-[(2-oxochromen-4-yl)amino]propyl]acetamide |
| SMILES | CN(CCCNc1cc(=O)oc2ccccc12)C(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-25(20(26)13-28-19-8-7-14(22)11-16(19)23)10-4-9-24-17-12-21(27)29-18-6-3-2-5-15(17)18/h2-3,5-8,11-12,24H,4,9-10,13H2,1H3 |
| InChIKey | ACRKDPHRWKNHMQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|