About 5-azido-1H-indole
5-azido-1H-indole (PubChem CID 3036180) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 5-azido-1H-indole.
Molecular Properties
| Compound Name | 5-azido-1H-indole |
| PubChem CID | 3036180 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-azido-1H-indole |
| SMILES | [N-]=[N+]=Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6N4/c9-12-11-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| InChIKey | AOGMRHJPLFEWKL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-1H-indole?
The IUPAC name of 5-azido-1H-indole (CID 3036180) is 5-azido-1H-indole.
What is the SMILES notation for 5-azido-1H-indole?
The canonical SMILES for 5-azido-1H-indole is [N-]=[N+]=Nc1ccc2[nH]ccc2c1.
What is the InChIKey of 5-azido-1H-indole?
The InChIKey is AOGMRHJPLFEWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c9-12-11-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H.
What are the key properties of 5-azido-1H-indole?
5-azido-1H-indole has a molecular weight of 158.16 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-1H-indole is sourced from PubChem (CID 3036180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).