C15H19NO3 — CID 3038696
(1S,10S,12R)-7,8-dimethoxy-2-methyl-11-oxa-2-azatetracyclo[7.4.1.05,14.010,12]tetradeca-5,7,9(14)-triene (PubChem CID 3038696) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (1S,10S,12R)-7,8-dimethoxy-2-methyl-11-oxa-2-azatetracyclo[7.4.1.05,14.010,12]tetradeca-5,7,9(14)-triene.
| Compound Name | (1S,10S,12R)-7,8-dimethoxy-2-methyl-11-oxa-2-azatetracyclo[7.4.1.05,14.010,12]tetradeca-5,7,9(14)-triene |
|---|---|
| PubChem CID | 3038696 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1S,10S,12R)-7,8-dimethoxy-2-methyl-11-oxa-2-azatetracyclo[7.4.1.05,14.010,12]tetradeca-5,7,9(14)-triene |
| SMILES | COc1cc2c3c(c1OC)[C@@H]1O[C@@H]1C[C@@H]3N(C)CC2 |
| InChI | InChI=1S/C15H19NO3/c1-16-5-4-8-6-10(17-2)14(18-3)13-12(8)9(16)7-11-15(13)19-11/h6,9,11,15H,4-5,7H2,1-3H3/t9-,11+,15+/m0/s1 |
| InChIKey | JWLCFWVVSYSILG-ZVWUFJHRSA-N |
| XLogP | 2.08 |
| TPSA | 34.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|