C17H18N4S — CID 3043863
5,6-diphenyl-2H-1,2,4-triazine-3-thione;ethanamine (PubChem CID 3043863) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 5,6-diphenyl-2H-1,2,4-triazine-3-thione;ethanamine.
| Compound Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;ethanamine |
|---|---|
| PubChem CID | 3043863 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;ethanamine |
| SMILES | CCN.S=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H11N3S.C2H7N/c19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12;1-2-3/h1-10H,(H,16,18,19);2-3H2,1H3 |
| InChIKey | DTDUOXXLVBXJPN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|