C25H28N6O3S — CID 30469291
2-ethyl-4,5-dimethyl-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 30469291) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethyl-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2-ethyl-4,5-dimethyl-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 30469291 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-ethyl-4,5-dimethyl-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2sc3nc(CC)nc(C)c3c2C)c2ccccc2c1=O |
| InChI | InChI=1S/C25H28N6O3S/c1-5-7-10-13-31-25(34)17-12-9-8-11-16(17)20(30-31)22(32)28-29-23(33)21-14(3)19-15(4)26-18(6-2)27-24(19)35-21/h8-9,11-12H,5-7,10,13H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | YKOKSPUEAVJAOH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|