C26H29NO4 — CID 3047537
1-(1,3-benzodioxol-5-yl)-2-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone (PubChem CID 3047537) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone |
|---|---|
| PubChem CID | 3047537 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@H](C2)N(CC(=O)c1ccc2c(c1)OCO2)CC3 |
| InChI | InChI=1S/C26H29NO4/c1-29-19-7-5-17-12-22-20-4-2-3-9-26(20,21(17)14-19)10-11-27(22)15-23(28)18-6-8-24-25(13-18)31-16-30-24/h5-8,13-14,20,22H,2-4,9-12,15-16H2,1H3/t20-,22-,26+/m0/s1 |
| InChIKey | YHJGLCFFKWWQME-WDZJFXIESA-N |
| XLogP | 4.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |