C30H35NO10 — CID 6916668
1-(1,3-benzodioxol-5-yl)-2-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 6916668) has the molecular formula C30H35NO10 and a molecular weight of 569.61 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 6916668 |
| Molecular Formula | C30H35NO10 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[(1S,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethanone;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@H]1[C@H](C2)N(CC(=O)c1ccc2c(c1)OCO2)CC3.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C26H29NO4.C4H6O6/c1-29-19-7-5-17-12-22-20-4-2-3-9-26(20,21(17)14-19)10-11-27(22)15-23(28)18-6-8-24-25(13-18)31-16-30-24;5-1(3(7)8)2(6)4(9)10/h5-8,13-14,20,22H,2-4,9-12,15-16H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t20-,22-,26-;1-,2-/m01/s1 |
| InChIKey | ZZKIJRYYULBAIP-LJLZOCBUSA-N |
| XLogP | 2.24 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |