C23H29NO6 — CID 118388842
2,3-dihydroxy-4-oxo-4-[[(1R,9R,10R)-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]butanoic acid (PubChem CID 118388842) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2,3-dihydroxy-4-oxo-4-[[(1R,9R,10R)-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]butanoic acid.
| Compound Name | 2,3-dihydroxy-4-oxo-4-[[(1R,9R,10R)-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 118388842 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2,3-dihydroxy-4-oxo-4-[[(1R,9R,10R)-17-prop-2-enyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]butanoic acid |
| SMILES | C=CCN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(OC(=O)C(O)C(O)C(=O)O)cc13 |
| InChI | InChI=1S/C23H29NO6/c1-2-10-24-11-9-23-8-4-3-5-16(23)18(24)12-14-6-7-15(13-17(14)23)30-22(29)20(26)19(25)21(27)28/h2,6-7,13,16,18-20,25-26H,1,3-5,8-12H2,(H,27,28)/t16-,18+,19?,20?,23+/m0/s1 |
| InChIKey | JJEQKZLAHHKCAU-BCRYRKMISA-N |
| XLogP | 1.64 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|