C17H26N4O3S3 — CID 30544561
N'-[5-[(3R)-dithiolan-3-yl]pentanoyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 30544561) has the molecular formula C17H26N4O3S3 and a molecular weight of 430.62 g/mol. Its IUPAC name is N'-[5-[(3R)-dithiolan-3-yl]pentanoyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[5-[(3R)-dithiolan-3-yl]pentanoyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 30544561 |
| Molecular Formula | C17H26N4O3S3 |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N'-[5-[(3R)-dithiolan-3-yl]pentanoyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C17H26N4O3S3/c1-12-15(26-17(18-12)21-7-9-24-10-8-21)16(23)20-19-14(22)5-3-2-4-13-6-11-25-27-13/h13H,2-11H2,1H3,(H,19,22)(H,20,23)/t13-/m1/s1 |
| InChIKey | SCGXYIDOXLMFDK-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|