C18H21N5O4S2 — CID 30548218
4-(2-cyanoethylsulfamoyl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 30548218) has the molecular formula C18H21N5O4S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 30548218 |
| Molecular Formula | C18H21N5O4S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)Nc2nc(CN3CCOCC3)cs2)cc1 |
| InChI | InChI=1S/C18H21N5O4S2/c19-6-1-7-20-29(25,26)16-4-2-14(3-5-16)17(24)22-18-21-15(13-28-18)12-23-8-10-27-11-9-23/h2-5,13,20H,1,7-12H2,(H,21,22,24) |
| InChIKey | SHTSMYLVSFYTOI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|