C17H23ClO4 — CID 3056195
methyl 6-chloro-4-hexyl-4-methyl-1,3-benzodioxine-2-carboxylate (PubChem CID 3056195) has the molecular formula C17H23ClO4 and a molecular weight of 326.82 g/mol. Its IUPAC name is methyl 6-chloro-4-hexyl-4-methyl-1,3-benzodioxine-2-carboxylate.
| Compound Name | methyl 6-chloro-4-hexyl-4-methyl-1,3-benzodioxine-2-carboxylate |
|---|---|
| PubChem CID | 3056195 |
| Molecular Formula | C17H23ClO4 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | methyl 6-chloro-4-hexyl-4-methyl-1,3-benzodioxine-2-carboxylate |
| SMILES | CCCCCCC1(C)OC(C(=O)OC)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H23ClO4/c1-4-5-6-7-10-17(2)13-11-12(18)8-9-14(13)21-16(22-17)15(19)20-3/h8-9,11,16H,4-7,10H2,1-3H3 |
| InChIKey | CHJDJXPQAZKBGE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|