C14H6I4N2O2 — CID 3056383
2-anilino-4,5,6,7-tetraiodoisoindole-1,3-dione (PubChem CID 3056383) has the molecular formula C14H6I4N2O2 and a molecular weight of 741.83 g/mol. Its IUPAC name is 2-anilino-4,5,6,7-tetraiodoisoindole-1,3-dione.
| Compound Name | 2-anilino-4,5,6,7-tetraiodoisoindole-1,3-dione |
|---|---|
| PubChem CID | 3056383 |
| Molecular Formula | C14H6I4N2O2 |
| Molecular Weight | 741.83 g/mol |
| Exact Mass | 741.66 |
| IUPAC Name | 2-anilino-4,5,6,7-tetraiodoisoindole-1,3-dione |
| SMILES | O=C1c2c(I)c(I)c(I)c(I)c2C(=O)N1Nc1ccccc1 |
| InChI | InChI=1S/C14H6I4N2O2/c15-9-7-8(10(16)12(18)11(9)17)14(22)20(13(7)21)19-6-4-2-1-3-5-6/h1-5,19H |
| InChIKey | NNFDNQSETOOMRY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|