About N-phenylpyrrol-1-amine
N-phenylpyrrol-1-amine (PubChem CID 13016198) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is N-phenylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-phenylpyrrol-1-amine |
| PubChem CID | 13016198 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | N-phenylpyrrol-1-amine |
| SMILES | c1ccc(Nn2cccc2)cc1 |
| InChI | InChI=1S/C10H10N2/c1-2-6-10(7-3-1)11-12-8-4-5-9-12/h1-9,11H |
| InChIKey | GZCDKNZPUSFDIZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylpyrrol-1-amine?
The IUPAC name of N-phenylpyrrol-1-amine (CID 13016198) is N-phenylpyrrol-1-amine.
What is the SMILES notation for N-phenylpyrrol-1-amine?
The canonical SMILES for N-phenylpyrrol-1-amine is c1ccc(Nn2cccc2)cc1.
What is the InChIKey of N-phenylpyrrol-1-amine?
The InChIKey is GZCDKNZPUSFDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-6-10(7-3-1)11-12-8-4-5-9-12/h1-9,11H.
What are the key properties of N-phenylpyrrol-1-amine?
N-phenylpyrrol-1-amine has a molecular weight of 158.20 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylpyrrol-1-amine is sourced from PubChem (CID 13016198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).