C21H33N3O8 — CID 3059994
1-(2-butyl-4-phenylpiperazin-1-yl)propan-2-amine;oxalic acid (PubChem CID 3059994) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-(2-butyl-4-phenylpiperazin-1-yl)propan-2-amine;oxalic acid.
| Compound Name | 1-(2-butyl-4-phenylpiperazin-1-yl)propan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 3059994 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-(2-butyl-4-phenylpiperazin-1-yl)propan-2-amine;oxalic acid |
| SMILES | CCCCC1CN(c2ccccc2)CCN1CC(C)N.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H29N3.2C2H2O4/c1-3-4-8-17-14-20(16-9-6-5-7-10-16)12-11-19(17)13-15(2)18;2*3-1(4)2(5)6/h5-7,9-10,15,17H,3-4,8,11-14,18H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | AWYNHRHCIJELDT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|