C6H16Cl2N2Pt — CID 3064225
4-methylpentane-1,2-diamine;platinum(2+);dichloride (PubChem CID 3064225) has the molecular formula C6H16Cl2N2Pt and a molecular weight of 382.19 g/mol. Its IUPAC name is 4-methylpentane-1,2-diamine;platinum(2+);dichloride.
| Compound Name | 4-methylpentane-1,2-diamine;platinum(2+);dichloride |
|---|---|
| PubChem CID | 3064225 |
| Molecular Formula | C6H16Cl2N2Pt |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 4-methylpentane-1,2-diamine;platinum(2+);dichloride |
| SMILES | CC(C)CC(N)CN.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C6H16N2.2ClH.Pt/c1-5(2)3-6(8)4-7;;;/h5-6H,3-4,7-8H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | CHNHTGPYXCOULM-UHFFFAOYSA-L |
| XLogP | -5.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |