C21H30N4O2S — CID 30710024
N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 30710024) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 30710024 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | CCC(CC)[C@H](CNC(=O)c1c[nH]c(=S)n1-c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H30N4O2S/c1-3-16(4-2)18(24-10-12-27-13-11-24)14-22-20(26)19-15-23-21(28)25(19)17-8-6-5-7-9-17/h5-9,15-16,18H,3-4,10-14H2,1-2H3,(H,22,26)(H,23,28)/t18-/m0/s1 |
| InChIKey | OTXBWYZHUGLUEH-SFHVURJKSA-N |
| XLogP | 3.40 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|