C15H17N3O3S — CID 102560806
N-(1,3-dioxan-4-ylmethyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 102560806) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 102560806 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | O=C(NCC1CCOCO1)c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S/c19-14(16-8-12-6-7-20-10-21-12)13-9-17-15(22)18(13)11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2,(H,16,19)(H,17,22) |
| InChIKey | XYUZMURPNBHVJB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|