C21H21N5O2S — CID 100748973
3-phenyl-N-[(3R)-1-(phenylcarbamoyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 100748973) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-phenyl-N-[(3R)-1-(phenylcarbamoyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | 3-phenyl-N-[(3R)-1-(phenylcarbamoyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 100748973 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 3-phenyl-N-[(3R)-1-(phenylcarbamoyl)pyrrolidin-3-yl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(C(=O)Nc2ccccc2)C1)c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N5O2S/c27-19(18-13-22-21(29)26(18)17-9-5-2-6-10-17)23-16-11-12-25(14-16)20(28)24-15-7-3-1-4-8-15/h1-10,13,16H,11-12,14H2,(H,22,29)(H,23,27)(H,24,28)/t16-/m1/s1 |
| InChIKey | OBMOSLDHDZXLTK-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|