C19H20F2N2O3S2 — CID 30735593
N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-methylbut-2-enamide (PubChem CID 30735593) has the molecular formula C19H20F2N2O3S2 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-methylbut-2-enamide.
| Compound Name | N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 30735593 |
| Molecular Formula | C19H20F2N2O3S2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1ccc(C)c(S(=O)(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F2N2O3S2/c1-12(2)10-18(24)22-15-5-4-13(3)17(11-15)28(25,26)23-14-6-8-16(9-7-14)27-19(20)21/h4-11,19,23H,1-3H3,(H,22,24) |
| InChIKey | ANGXBOZTLPEJCR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|