C21H18F2N4O5S2 — CID 4102923
1-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(4-nitrophenyl)urea (PubChem CID 4102923) has the molecular formula C21H18F2N4O5S2 and a molecular weight of 508.53 g/mol. Its IUPAC name is 1-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 4102923 |
| Molecular Formula | C21H18F2N4O5S2 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 1-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]-4-methylphenyl]-3-(4-nitrophenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1S(=O)(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H18F2N4O5S2/c1-13-2-3-16(25-21(28)24-14-4-8-17(9-5-14)27(29)30)12-19(13)34(31,32)26-15-6-10-18(11-7-15)33-20(22)23/h2-12,20,26H,1H3,(H2,24,25,28) |
| InChIKey | USMXNXYURKGOAF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|