C22H22N4OS2 — CID 30740699
8-[[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methyl]isoquinolin-7-ol (PubChem CID 30740699) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 8-[[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methyl]isoquinolin-7-ol.
| Compound Name | 8-[[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methyl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 30740699 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 8-[[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methyl]isoquinolin-7-ol |
| SMILES | Oc1ccc2ccncc2c1CN1CCN(Cc2csc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C22H22N4OS2/c27-21-2-1-16-3-5-23-11-19(16)20(21)13-26-8-6-25(7-9-26)12-18-15-29-22(24-18)17-4-10-28-14-17/h1-5,10-11,14-15,27H,6-9,12-13H2 |
| InChIKey | JCUJXFFWJDUNFD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|