C19H10Cl2N4O2S — CID 3074608
3-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one (PubChem CID 3074608) has the molecular formula C19H10Cl2N4O2S and a molecular weight of 429.29 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one.
| Compound Name | 3-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 3074608 |
| Molecular Formula | C19H10Cl2N4O2S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 3-[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nnc2n1N=C(c1ccc(Cl)cc1Cl)CS2 |
| InChI | InChI=1S/C19H10Cl2N4O2S/c20-11-5-6-12(14(21)8-11)15-9-28-19-23-22-17(25(19)24-15)13-7-10-3-1-2-4-16(10)27-18(13)26/h1-8H,9H2 |
| InChIKey | TYKSBJZFHADYQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|