C9H5ClF3N5O2 — CID 30773040
3-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-5-(trifluoromethyl)pyridine (PubChem CID 30773040) has the molecular formula C9H5ClF3N5O2 and a molecular weight of 307.62 g/mol. Its IUPAC name is 3-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 30773040 |
| Molecular Formula | C9H5ClF3N5O2 |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 3-chloro-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-5-(trifluoromethyl)pyridine |
| SMILES | O=[N+]([O-])c1ncn(Cc2ncc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C9H5ClF3N5O2/c10-6-1-5(9(11,12)13)2-14-7(6)3-17-4-15-8(16-17)18(19)20/h1-2,4H,3H2 |
| InChIKey | UDYQEXDTJJXFJG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|