C13H12ClF3N6O — CID 103596103
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-(dimethylaminomethylidene)triazole-4-carboxamide (PubChem CID 103596103) has the molecular formula C13H12ClF3N6O and a molecular weight of 360.73 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-(dimethylaminomethylidene)triazole-4-carboxamide.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-(dimethylaminomethylidene)triazole-4-carboxamide |
|---|---|
| PubChem CID | 103596103 |
| Molecular Formula | C13H12ClF3N6O |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-(dimethylaminomethylidene)triazole-4-carboxamide |
| SMILES | CN(C)/C=N/C(=O)c1cn(Cc2ncc(C(F)(F)F)cc2Cl)nn1 |
| InChI | InChI=1S/C13H12ClF3N6O/c1-22(2)7-19-12(24)11-6-23(21-20-11)5-10-9(14)3-8(4-18-10)13(15,16)17/h3-4,6-7H,5H2,1-2H3/b19-7+ |
| InChIKey | CYBDACLPNVIRCR-FBCYGCLPSA-N |
| XLogP | 2.12 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|