C19H17FN2O4S — CID 30784702
4-[[5-(4-fluorophenyl)furan-2-yl]methylsulfamoyl]-N-methylbenzamide (PubChem CID 30784702) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-[[5-(4-fluorophenyl)furan-2-yl]methylsulfamoyl]-N-methylbenzamide.
| Compound Name | 4-[[5-(4-fluorophenyl)furan-2-yl]methylsulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 30784702 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 4-[[5-(4-fluorophenyl)furan-2-yl]methylsulfamoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)NCc2ccc(-c3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C19H17FN2O4S/c1-21-19(23)14-4-9-17(10-5-14)27(24,25)22-12-16-8-11-18(26-16)13-2-6-15(20)7-3-13/h2-11,22H,12H2,1H3,(H,21,23) |
| InChIKey | GHVLHZLXRVUOMB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |