C20H20BrN3O4S — CID 30787552
5-bromo-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1H-indole-2-carboxamide (PubChem CID 30787552) has the molecular formula C20H20BrN3O4S and a molecular weight of 478.37 g/mol. Its IUPAC name is 5-bromo-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 30787552 |
| Molecular Formula | C20H20BrN3O4S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 5-bromo-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3cc(Br)ccc3[nH]2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H20BrN3O4S/c1-13-2-4-16(12-19(13)29(26,27)24-6-8-28-9-7-24)22-20(25)18-11-14-10-15(21)3-5-17(14)23-18/h2-5,10-12,23H,6-9H2,1H3,(H,22,25) |
| InChIKey | USKRIXFFBRPHKC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |