C9H16N3O4P — CID 3079427
diazanium;dioxido-oxo-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-lambda5-phosphane (PubChem CID 3079427) has the molecular formula C9H16N3O4P and a molecular weight of 261.22 g/mol. Its IUPAC name is diazanium;dioxido-oxo-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-lambda5-phosphane.
| Compound Name | diazanium;dioxido-oxo-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-lambda5-phosphane |
|---|---|
| PubChem CID | 3079427 |
| Molecular Formula | C9H16N3O4P |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | diazanium;dioxido-oxo-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-lambda5-phosphane |
| SMILES | O=P([O-])([O-])C1CC(c2ccccc2)=NO1.[NH4+].[NH4+] |
| InChI | InChI=1S/C9H10NO4P.2H3N/c11-15(12,13)9-6-8(10-14-9)7-4-2-1-3-5-7;;/h1-5,9H,6H2,(H2,11,12,13);2*1H3 |
| InChIKey | LWGJZTZMEDQCPS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 157.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|