C11H14NO2P — CID 3079421
5-dimethylphosphoryl-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 3079421) has the molecular formula C11H14NO2P and a molecular weight of 223.21 g/mol. Its IUPAC name is 5-dimethylphosphoryl-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-dimethylphosphoryl-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 3079421 |
| Molecular Formula | C11H14NO2P |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-dimethylphosphoryl-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | CP(C)(=O)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C11H14NO2P/c1-15(2,13)11-8-10(12-14-11)9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3 |
| InChIKey | WCEFMFNOBWCAEV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|