C17H16Cl3N3O3 — CID 30804766
(2R)-N-(2-chloro-5-nitrophenyl)-2-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]propanamide (PubChem CID 30804766) has the molecular formula C17H16Cl3N3O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-nitrophenyl)-2-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]propanamide.
| Compound Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 30804766 |
| Molecular Formula | C17H16Cl3N3O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]propanamide |
| SMILES | C[C@@H](N[C@H](C)c1ccc(Cl)c(Cl)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H16Cl3N3O3/c1-9(11-3-5-13(18)15(20)7-11)21-10(2)17(24)22-16-8-12(23(25)26)4-6-14(16)19/h3-10,21H,1-2H3,(H,22,24)/t9-,10-/m1/s1 |
| InChIKey | UUGQUGJNWVIDNO-NXEZZACHSA-N |
| XLogP | 5.23 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|