C19H27FN2O5S — CID 30825477
[(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(4-fluorophenyl)sulfonylamino]butanoate (PubChem CID 30825477) has the molecular formula C19H27FN2O5S and a molecular weight of 414.50 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(4-fluorophenyl)sulfonylamino]butanoate.
| Compound Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(4-fluorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 30825477 |
| Molecular Formula | C19H27FN2O5S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(2S)-1-(4-methylpiperidin-1-yl)-1-oxopropan-2-yl] 4-[(4-fluorophenyl)sulfonylamino]butanoate |
| SMILES | CC1CCN(C(=O)[C@H](C)OC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O5S/c1-14-9-12-22(13-10-14)19(24)15(2)27-18(23)4-3-11-21-28(25,26)17-7-5-16(20)6-8-17/h5-8,14-15,21H,3-4,9-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | QEMCYUWAXSAWGN-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|