C20H23FN4O7S — CID 30826060
N-[5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4-fluoro-2-nitrophenyl]acetamide (PubChem CID 30826060) has the molecular formula C20H23FN4O7S and a molecular weight of 482.49 g/mol. Its IUPAC name is N-[5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4-fluoro-2-nitrophenyl]acetamide.
| Compound Name | N-[5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4-fluoro-2-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 30826060 |
| Molecular Formula | C20H23FN4O7S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[5-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4-fluoro-2-nitrophenyl]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCN(c3cc(NC(C)=O)c([N+](=O)[O-])cc3F)CC2)c1 |
| InChI | InChI=1S/C20H23FN4O7S/c1-13(26)22-16-12-17(15(21)11-18(16)25(27)28)23-6-8-24(9-7-23)33(29,30)20-10-14(31-2)4-5-19(20)32-3/h4-5,10-12H,6-9H2,1-3H3,(H,22,26) |
| InChIKey | IMCABJITIZXQGR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|