C24H24N4O3S — CID 30894546
N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 30894546) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 30894546 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(/C=C/c2ccccn2)c1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C24H24N4O3S/c29-24(20-11-15-28(16-12-20)32(30,31)23-8-4-13-25-18-23)27-22-7-3-5-19(17-22)9-10-21-6-1-2-14-26-21/h1-10,13-14,17-18,20H,11-12,15-16H2,(H,27,29)/b10-9+ |
| InChIKey | GSGRLNWCYAMJGJ-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |