C22H28N6O — CID 30900310
1-ethyl-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]benzotriazole-5-carboxamide (PubChem CID 30900310) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-ethyl-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]benzotriazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 30900310 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-ethyl-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]benzotriazole-5-carboxamide |
| SMILES | CCn1nnc2cc(C(=O)NCCN3CCN(c4cccc(C)c4)CC3)ccc21 |
| InChI | InChI=1S/C22H28N6O/c1-3-28-21-8-7-18(16-20(21)24-25-28)22(29)23-9-10-26-11-13-27(14-12-26)19-6-4-5-17(2)15-19/h4-8,15-16H,3,9-14H2,1-2H3,(H,23,29) |
| InChIKey | HMLSTRSGMIRMTI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |