C12H16Cl3N3O3 — CID 3090194
2,2-dimethyl-N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]propanamide (PubChem CID 3090194) has the molecular formula C12H16Cl3N3O3 and a molecular weight of 356.64 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 3090194 |
| Molecular Formula | C12H16Cl3N3O3 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]propanamide |
| SMILES | Cc1cn(C(NC(=O)C(C)(C)C)C(Cl)(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16Cl3N3O3/c1-6-5-18(10(21)16-7(6)19)8(12(13,14)15)17-9(20)11(2,3)4/h5,8H,1-4H3,(H,17,20)(H,16,19,21) |
| InChIKey | DWGOTSMHXCYCBW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|