C10H16Cl3N3O2 — CID 90680091
5-[bis(2-chloroethyl)aminomethyl]-1-methylpyrimidine-2,4-dione;hydrochloride (PubChem CID 90680091) has the molecular formula C10H16Cl3N3O2 and a molecular weight of 316.62 g/mol. Its IUPAC name is 5-[bis(2-chloroethyl)aminomethyl]-1-methylpyrimidine-2,4-dione;hydrochloride.
| Compound Name | 5-[bis(2-chloroethyl)aminomethyl]-1-methylpyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 90680091 |
| Molecular Formula | C10H16Cl3N3O2 |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-[bis(2-chloroethyl)aminomethyl]-1-methylpyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Cn1cc(CN(CCCl)CCCl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15Cl2N3O2.ClH/c1-14-6-8(9(16)13-10(14)17)7-15(4-2-11)5-3-12;/h6H,2-5,7H2,1H3,(H,13,16,17);1H |
| InChIKey | AEPSYEBBHKNNAK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|