C17H20N6O4 — CID 30910565
(1-butyltetrazol-5-yl)methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 30910565) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 30910565 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | CCCCn1nnnc1COC(=O)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C17H20N6O4/c1-2-3-8-23-14(19-20-21-23)11-27-16(25)13-7-5-4-6-12(13)10-22-15(24)9-18-17(22)26/h4-7H,2-3,8-11H2,1H3,(H,18,26) |
| InChIKey | WRZHBYQKESNKMA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|