C30H35BF2O4 — CID 3092058
1-[6-(4-butoxyphenyl)-4-[2-(4-butoxyphenyl)ethenyl]-2-difluoroboranyloxycyclohexa-1,3-dien-1-yl]ethanone (PubChem CID 3092058) has the molecular formula C30H35BF2O4 and a molecular weight of 508.41 g/mol. Its IUPAC name is 1-[6-(4-butoxyphenyl)-4-[2-(4-butoxyphenyl)ethenyl]-2-difluoroboranyloxycyclohexa-1,3-dien-1-yl]ethanone.
| Compound Name | 1-[6-(4-butoxyphenyl)-4-[2-(4-butoxyphenyl)ethenyl]-2-difluoroboranyloxycyclohexa-1,3-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 3092058 |
| Molecular Formula | C30H35BF2O4 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 1-[6-(4-butoxyphenyl)-4-[2-(4-butoxyphenyl)ethenyl]-2-difluoroboranyloxycyclohexa-1,3-dien-1-yl]ethanone |
| SMILES | CCCCOc1ccc(C=CC2=CC(OB(F)F)=C(C(C)=O)C(c3ccc(OCCCC)cc3)C2)cc1 |
| InChI | InChI=1S/C30H35BF2O4/c1-4-6-18-35-26-14-10-23(11-15-26)8-9-24-20-28(30(22(3)34)29(21-24)37-31(32)33)25-12-16-27(17-13-25)36-19-7-5-2/h8-17,21,28H,4-7,18-20H2,1-3H3 |
| InChIKey | QPWVDTWPGACHDT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|