C30H36O4 — CID 28796230
(5R,6R)-6-acetyl-5-(4-butoxyphenyl)-3-[(E)-2-(4-butoxyphenyl)ethenyl]cyclohex-2-en-1-one (PubChem CID 28796230) has the molecular formula C30H36O4 and a molecular weight of 460.61 g/mol. Its IUPAC name is (5R,6R)-6-acetyl-5-(4-butoxyphenyl)-3-[(E)-2-(4-butoxyphenyl)ethenyl]cyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-acetyl-5-(4-butoxyphenyl)-3-[(E)-2-(4-butoxyphenyl)ethenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 28796230 |
| Molecular Formula | C30H36O4 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (5R,6R)-6-acetyl-5-(4-butoxyphenyl)-3-[(E)-2-(4-butoxyphenyl)ethenyl]cyclohex-2-en-1-one |
| SMILES | CCCCOc1ccc(/C=C/C2=CC(=O)[C@@H](C(C)=O)[C@H](c3ccc(OCCCC)cc3)C2)cc1 |
| InChI | InChI=1S/C30H36O4/c1-4-6-18-33-26-14-10-23(11-15-26)8-9-24-20-28(30(22(3)31)29(32)21-24)25-12-16-27(17-13-25)34-19-7-5-2/h8-17,21,28,30H,4-7,18-20H2,1-3H3/b9-8+/t28-,30-/m0/s1 |
| InChIKey | NJMKHCILAGUBSE-QEYSZGGYSA-N |
| XLogP | 6.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|