C19H16ClF2N7O3 — CID 30938148
(2-chloro-5-nitrophenyl)-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]methanone (PubChem CID 30938148) has the molecular formula C19H16ClF2N7O3 and a molecular weight of 463.83 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 30938148 |
| Molecular Formula | C19H16ClF2N7O3 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[4-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N1CCN(Cc2nnnn2-c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H16ClF2N7O3/c20-15-3-1-13(29(31)32)9-14(15)19(30)27-7-5-26(6-8-27)11-18-23-24-25-28(18)12-2-4-16(21)17(22)10-12/h1-4,9-10H,5-8,11H2 |
| InChIKey | YBDUZQNAELROCE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|