C22H14FN7O5 — CID 3095581
5-[5-[[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid (PubChem CID 3095581) has the molecular formula C22H14FN7O5 and a molecular weight of 475.40 g/mol. Its IUPAC name is 5-[5-[[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[5-[[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 3095581 |
| Molecular Formula | C22H14FN7O5 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 5-[5-[[[6-(2-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C=NNc3nc4nonc4nc3Nc3ccccc3F)o2)ccc1O |
| InChI | InChI=1S/C22H14FN7O5/c23-14-3-1-2-4-15(14)25-18-19(27-21-20(26-18)29-35-30-21)28-24-10-12-6-8-17(34-12)11-5-7-16(31)13(9-11)22(32)33/h1-10,31H,(H,32,33)(H,25,26,29)(H,27,28,30) |
| InChIKey | KJNSJDSFDDGSRP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 171.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|