C18H17Cl3N6O2 — CID 3096090
N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]benzamide (PubChem CID 3096090) has the molecular formula C18H17Cl3N6O2 and a molecular weight of 455.73 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]benzamide.
| Compound Name | N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 3096090 |
| Molecular Formula | C18H17Cl3N6O2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]benzamide |
| SMILES | O=C(NC(n1cnc2c(N3CCOCC3)ncnc21)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl3N6O2/c19-18(20,21)17(25-16(28)12-4-2-1-3-5-12)27-11-24-13-14(22-10-23-15(13)27)26-6-8-29-9-7-26/h1-5,10-11,17H,6-9H2,(H,25,28) |
| InChIKey | LMRBCYJZHSNLLE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|