C24H22N2O5S — CID 30973767
[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 30973767) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 30973767 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)c2ccccc2NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C24H22N2O5S/c1-16(27)25-14-18-11-12-22(32-18)21(28)15-31-24(30)19-9-5-6-10-20(19)26-23(29)13-17-7-3-2-4-8-17/h2-12H,13-15H2,1H3,(H,25,27)(H,26,29) |
| InChIKey | NXSGZZKDHSSTJG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |