C25H26N2O3S — CID 3100434
O-[4-[(4-methoxyphenyl)carbamoyl]phenyl] N-benzyl-N-propylcarbamothioate (PubChem CID 3100434) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is O-[4-[(4-methoxyphenyl)carbamoyl]phenyl] N-benzyl-N-propylcarbamothioate.
| Compound Name | O-[4-[(4-methoxyphenyl)carbamoyl]phenyl] N-benzyl-N-propylcarbamothioate |
|---|---|
| PubChem CID | 3100434 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | O-[4-[(4-methoxyphenyl)carbamoyl]phenyl] N-benzyl-N-propylcarbamothioate |
| SMILES | CCCN(Cc1ccccc1)C(=S)Oc1ccc(C(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-3-17-27(18-19-7-5-4-6-8-19)25(31)30-23-13-9-20(10-14-23)24(28)26-21-11-15-22(29-2)16-12-21/h4-16H,3,17-18H2,1-2H3,(H,26,28) |
| InChIKey | XNEUGGPNCBOSRB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|