C17H19ClN2O3 — CID 31054798
2-(4-chloro-2,5-dimethoxyanilino)-N-methyl-N-phenylacetamide (PubChem CID 31054798) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-methyl-N-phenylacetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 31054798 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-methyl-N-phenylacetamide |
| SMILES | COc1cc(NCC(=O)N(C)c2ccccc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O3/c1-20(12-7-5-4-6-8-12)17(21)11-19-14-10-15(22-2)13(18)9-16(14)23-3/h4-10,19H,11H2,1-3H3 |
| InChIKey | JEYHTOSAVDULAD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |