C14H28N2O2S — CID 31066371
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azepane-1-sulfonamide (PubChem CID 31066371) has the molecular formula C14H28N2O2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azepane-1-sulfonamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 31066371 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azepane-1-sulfonamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NS(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H28N2O2S/c1-12-8-7-9-14(13(12)2)15-19(17,18)16-10-5-3-4-6-11-16/h12-15H,3-11H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | ZULFKHCJHIFTKB-MGPQQGTHSA-N |
| XLogP | 2.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |