C24H28N2O3S2 — CID 3110796
benzyl carbamimidothioate;2-(2-tert-butylphenyl)benzenesulfonic acid (PubChem CID 3110796) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is benzyl carbamimidothioate;2-(2-tert-butylphenyl)benzenesulfonic acid.
| Compound Name | benzyl carbamimidothioate;2-(2-tert-butylphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 3110796 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | benzyl carbamimidothioate;2-(2-tert-butylphenyl)benzenesulfonic acid |
| SMILES | CC(C)(C)c1ccccc1-c1ccccc1S(=O)(=O)O.[H]/N=C(\N)SCc1ccccc1 |
| InChI | InChI=1S/C16H18O3S.C8H10N2S/c1-16(2,3)14-10-6-4-8-12(14)13-9-5-7-11-15(13)20(17,18)19;9-8(10)11-6-7-4-2-1-3-5-7/h4-11H,1-3H3,(H,17,18,19);1-5H,6H2,(H3,9,10) |
| InChIKey | HDMDALNDDRWHNR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|