C24H22N4O5S — CID 31110652
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-methoxy-2-nitrobenzenesulfonamide (PubChem CID 31110652) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-methoxy-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-methoxy-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 31110652 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-methoxy-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cn(Cc3ccccc3)nc2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22N4O5S/c1-33-21-12-13-23(22(14-21)28(29)30)34(31,32)25-15-20-17-27(16-18-8-4-2-5-9-18)26-24(20)19-10-6-3-7-11-19/h2-14,17,25H,15-16H2,1H3 |
| InChIKey | BDQRVOZSVBEWMH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|