C15H13N5O — CID 3115142
4-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]diazenyl]phenol (PubChem CID 3115142) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]diazenyl]phenol.
| Compound Name | 4-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]diazenyl]phenol |
|---|---|
| PubChem CID | 3115142 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]diazenyl]phenol |
| SMILES | Cc1ccc(-c2nc(/N=N/c3ccc(O)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C15H13N5O/c1-10-2-4-11(5-3-10)14-16-15(20-18-14)19-17-12-6-8-13(21)9-7-12/h2-9,21H,1H3,(H,16,18,20)/b19-17+ |
| InChIKey | ZFISAADNUJLVHY-HTXNQAPBSA-N |
| XLogP | 3.90 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|